C14H16FN3O3 — CID 83098403
N-cyclopropyl-4-(6-fluoropyridine-3-carbonyl)morpholine-3-carboxamide (PubChem CID 83098403) has the molecular formula C14H16FN3O3 and a molecular weight of 293.30 g/mol. Its IUPAC name is N-cyclopropyl-4-(6-fluoropyridine-3-carbonyl)morpholine-3-carboxamide.
| Compound Name | N-cyclopropyl-4-(6-fluoropyridine-3-carbonyl)morpholine-3-carboxamide |
|---|---|
| PubChem CID | 83098403 |
| Molecular Formula | C14H16FN3O3 |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | N-cyclopropyl-4-(6-fluoropyridine-3-carbonyl)morpholine-3-carboxamide |
| SMILES | O=C(NC1CC1)C1COCCN1C(=O)c1ccc(F)nc1 |
| InChI | InChI=1S/C14H16FN3O3/c15-12-4-1-9(7-16-12)14(20)18-5-6-21-8-11(18)13(19)17-10-2-3-10/h1,4,7,10-11H,2-3,5-6,8H2,(H,17,19) |
| InChIKey | SNVZCWAMNTTZNT-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|