C14H15Cl2N3O2 — CID 60733404
N-cyclopropyl-1-(5,6-dichloropyridine-3-carbonyl)pyrrolidine-2-carboxamide (PubChem CID 60733404) has the molecular formula C14H15Cl2N3O2 and a molecular weight of 328.20 g/mol. Its IUPAC name is N-cyclopropyl-1-(5,6-dichloropyridine-3-carbonyl)pyrrolidine-2-carboxamide.
| Compound Name | N-cyclopropyl-1-(5,6-dichloropyridine-3-carbonyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 60733404 |
| Molecular Formula | C14H15Cl2N3O2 |
| Molecular Weight | 328.20 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | N-cyclopropyl-1-(5,6-dichloropyridine-3-carbonyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(NC1CC1)C1CCCN1C(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H15Cl2N3O2/c15-10-6-8(7-17-12(10)16)14(21)19-5-1-2-11(19)13(20)18-9-3-4-9/h6-7,9,11H,1-5H2,(H,18,20) |
| InChIKey | HKKIYFCGYZVCOS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.20 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|