C12H12Cl2N2O3 — CID 43388589
methyl 1-(5,6-dichloropyridine-3-carbonyl)pyrrolidine-2-carboxylate (PubChem CID 43388589) has the molecular formula C12H12Cl2N2O3 and a molecular weight of 303.15 g/mol. Its IUPAC name is methyl 1-(5,6-dichloropyridine-3-carbonyl)pyrrolidine-2-carboxylate.
| Compound Name | methyl 1-(5,6-dichloropyridine-3-carbonyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 43388589 |
| Molecular Formula | C12H12Cl2N2O3 |
| Molecular Weight | 303.15 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | methyl 1-(5,6-dichloropyridine-3-carbonyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CCCN1C(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H12Cl2N2O3/c1-19-12(18)9-3-2-4-16(9)11(17)7-5-8(13)10(14)15-6-7/h5-6,9H,2-4H2,1H3 |
| InChIKey | YFGJOPXUBXASNK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.15 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|