C14H19NO3S3 — CID 125130608
2-(4-methylphenyl)sulfanyl-1-[(3R)-3-methylsulfonylthiomorpholin-4-yl]ethanone (PubChem CID 125130608) has the molecular formula C14H19NO3S3 and a molecular weight of 345.51 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfanyl-1-[(3R)-3-methylsulfonylthiomorpholin-4-yl]ethanone.
| Compound Name | 2-(4-methylphenyl)sulfanyl-1-[(3R)-3-methylsulfonylthiomorpholin-4-yl]ethanone |
|---|---|
| PubChem CID | 125130608 |
| Molecular Formula | C14H19NO3S3 |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | 2-(4-methylphenyl)sulfanyl-1-[(3R)-3-methylsulfonylthiomorpholin-4-yl]ethanone |
| SMILES | Cc1ccc(SCC(=O)N2CCSC[C@H]2S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C14H19NO3S3/c1-11-3-5-12(6-4-11)20-9-13(16)15-7-8-19-10-14(15)21(2,17)18/h3-6,14H,7-10H2,1-2H3/t14-/m1/s1 |
| InChIKey | HJKOJRDVJWWVJY-CQSZACIVSA-N |
| XLogP | 2.03 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |