C14H17F2NO3S2 — CID 129358749
2-[3-(difluoromethyl)phenyl]-1-[(3R)-3-methylsulfonylthiomorpholin-4-yl]ethanone (PubChem CID 129358749) has the molecular formula C14H17F2NO3S2 and a molecular weight of 349.42 g/mol. Its IUPAC name is 2-[3-(difluoromethyl)phenyl]-1-[(3R)-3-methylsulfonylthiomorpholin-4-yl]ethanone.
| Compound Name | 2-[3-(difluoromethyl)phenyl]-1-[(3R)-3-methylsulfonylthiomorpholin-4-yl]ethanone |
|---|---|
| PubChem CID | 129358749 |
| Molecular Formula | C14H17F2NO3S2 |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 2-[3-(difluoromethyl)phenyl]-1-[(3R)-3-methylsulfonylthiomorpholin-4-yl]ethanone |
| SMILES | CS(=O)(=O)[C@@H]1CSCCN1C(=O)Cc1cccc(C(F)F)c1 |
| InChI | InChI=1S/C14H17F2NO3S2/c1-22(19,20)13-9-21-6-5-17(13)12(18)8-10-3-2-4-11(7-10)14(15)16/h2-4,7,13-14H,5-6,8-9H2,1H3/t13-/m1/s1 |
| InChIKey | UKMLHLIDEPZNFX-CYBMUJFWSA-N |
| XLogP | 2.11 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |