C14H18FNO4S2 — CID 125131194
(2S)-2-(3-fluorophenoxy)-1-[(3S)-3-methylsulfonylthiomorpholin-4-yl]propan-1-one (PubChem CID 125131194) has the molecular formula C14H18FNO4S2 and a molecular weight of 347.43 g/mol. Its IUPAC name is (2S)-2-(3-fluorophenoxy)-1-[(3S)-3-methylsulfonylthiomorpholin-4-yl]propan-1-one.
| Compound Name | (2S)-2-(3-fluorophenoxy)-1-[(3S)-3-methylsulfonylthiomorpholin-4-yl]propan-1-one |
|---|---|
| PubChem CID | 125131194 |
| Molecular Formula | C14H18FNO4S2 |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | (2S)-2-(3-fluorophenoxy)-1-[(3S)-3-methylsulfonylthiomorpholin-4-yl]propan-1-one |
| SMILES | C[C@H](Oc1cccc(F)c1)C(=O)N1CCSC[C@@H]1S(C)(=O)=O |
| InChI | InChI=1S/C14H18FNO4S2/c1-10(20-12-5-3-4-11(15)8-12)14(17)16-6-7-21-9-13(16)22(2,18)19/h3-5,8,10,13H,6-7,9H2,1-2H3/t10-,13-/m0/s1 |
| InChIKey | WTAGCZBDZNJIBY-GWCFXTLKSA-N |
| XLogP | 1.54 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |