C8H15NO3S3 — CID 107031839
1-(3-methylsulfonylthiomorpholin-4-yl)-2-sulfanylpropan-1-one (PubChem CID 107031839) has the molecular formula C8H15NO3S3 and a molecular weight of 269.41 g/mol. Its IUPAC name is 1-(3-methylsulfonylthiomorpholin-4-yl)-2-sulfanylpropan-1-one.
| Compound Name | 1-(3-methylsulfonylthiomorpholin-4-yl)-2-sulfanylpropan-1-one |
|---|---|
| PubChem CID | 107031839 |
| Molecular Formula | C8H15NO3S3 |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.02 |
| IUPAC Name | 1-(3-methylsulfonylthiomorpholin-4-yl)-2-sulfanylpropan-1-one |
| SMILES | CC(S)C(=O)N1CCSCC1S(C)(=O)=O |
| InChI | InChI=1S/C8H15NO3S3/c1-6(13)8(10)9-3-4-14-5-7(9)15(2,11)12/h6-7,13H,3-5H2,1-2H3 |
| InChIKey | BZIVTBWIHAZRNE-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 54.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|