C7H14N2O3S2 — CID 116656564
N-methyl-3-methylsulfonylthiomorpholine-4-carboxamide (PubChem CID 116656564) has the molecular formula C7H14N2O3S2 and a molecular weight of 238.33 g/mol. Its IUPAC name is N-methyl-3-methylsulfonylthiomorpholine-4-carboxamide.
| Compound Name | N-methyl-3-methylsulfonylthiomorpholine-4-carboxamide |
|---|---|
| PubChem CID | 116656564 |
| Molecular Formula | C7H14N2O3S2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | N-methyl-3-methylsulfonylthiomorpholine-4-carboxamide |
| SMILES | CNC(=O)N1CCSCC1S(C)(=O)=O |
| InChI | InChI=1S/C7H14N2O3S2/c1-8-7(10)9-3-4-13-5-6(9)14(2,11)12/h6H,3-5H2,1-2H3,(H,8,10) |
| InChIKey | CAQRNQBUPRMOBP-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |