C9H15ClN2O4S2 — CID 66381919
N-(3-chloropropanoyl)-3-methylsulfonylthiomorpholine-4-carboxamide (PubChem CID 66381919) has the molecular formula C9H15ClN2O4S2 and a molecular weight of 314.82 g/mol. Its IUPAC name is N-(3-chloropropanoyl)-3-methylsulfonylthiomorpholine-4-carboxamide.
| Compound Name | N-(3-chloropropanoyl)-3-methylsulfonylthiomorpholine-4-carboxamide |
|---|---|
| PubChem CID | 66381919 |
| Molecular Formula | C9H15ClN2O4S2 |
| Molecular Weight | 314.82 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | N-(3-chloropropanoyl)-3-methylsulfonylthiomorpholine-4-carboxamide |
| SMILES | CS(=O)(=O)C1CSCCN1C(=O)NC(=O)CCCl |
| InChI | InChI=1S/C9H15ClN2O4S2/c1-18(15,16)8-6-17-5-4-12(8)9(14)11-7(13)2-3-10/h8H,2-6H2,1H3,(H,11,13,14) |
| InChIKey | JTFQOZDLZVJRCT-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.82 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|