C10H18N2O6S2 — CID 81081683
3-methoxy-2-[(3-methylsulfonylthiomorpholine-4-carbonyl)amino]propanoic acid (PubChem CID 81081683) has the molecular formula C10H18N2O6S2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 3-methoxy-2-[(3-methylsulfonylthiomorpholine-4-carbonyl)amino]propanoic acid.
| Compound Name | 3-methoxy-2-[(3-methylsulfonylthiomorpholine-4-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 81081683 |
| Molecular Formula | C10H18N2O6S2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 3-methoxy-2-[(3-methylsulfonylthiomorpholine-4-carbonyl)amino]propanoic acid |
| SMILES | COCC(NC(=O)N1CCSCC1S(C)(=O)=O)C(=O)O |
| InChI | InChI=1S/C10H18N2O6S2/c1-18-5-7(9(13)14)11-10(15)12-3-4-19-6-8(12)20(2,16)17/h7-8H,3-6H2,1-2H3,(H,11,15)(H,13,14) |
| InChIKey | CGCACCNWAQXAOY-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |