C11H15NO4S2 — CID 66382608
1-(furan-2-yl)-2-(3-methylsulfonylthiomorpholin-4-yl)ethanone (PubChem CID 66382608) has the molecular formula C11H15NO4S2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 1-(furan-2-yl)-2-(3-methylsulfonylthiomorpholin-4-yl)ethanone.
| Compound Name | 1-(furan-2-yl)-2-(3-methylsulfonylthiomorpholin-4-yl)ethanone |
|---|---|
| PubChem CID | 66382608 |
| Molecular Formula | C11H15NO4S2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 1-(furan-2-yl)-2-(3-methylsulfonylthiomorpholin-4-yl)ethanone |
| SMILES | CS(=O)(=O)C1CSCCN1CC(=O)c1ccco1 |
| InChI | InChI=1S/C11H15NO4S2/c1-18(14,15)11-8-17-6-4-12(11)7-9(13)10-3-2-5-16-10/h2-3,5,11H,4,6-8H2,1H3 |
| InChIKey | AQRBSBNBGROTJB-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |