C15H23NO3S2 — CID 66382639
1-(4-methylphenyl)-3-(3-methylsulfonylthiomorpholin-4-yl)propan-1-ol (PubChem CID 66382639) has the molecular formula C15H23NO3S2 and a molecular weight of 329.49 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3-(3-methylsulfonylthiomorpholin-4-yl)propan-1-ol.
| Compound Name | 1-(4-methylphenyl)-3-(3-methylsulfonylthiomorpholin-4-yl)propan-1-ol |
|---|---|
| PubChem CID | 66382639 |
| Molecular Formula | C15H23NO3S2 |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 1-(4-methylphenyl)-3-(3-methylsulfonylthiomorpholin-4-yl)propan-1-ol |
| SMILES | Cc1ccc(C(O)CCN2CCSCC2S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C15H23NO3S2/c1-12-3-5-13(6-4-12)14(17)7-8-16-9-10-20-11-15(16)21(2,18)19/h3-6,14-15,17H,7-11H2,1-2H3 |
| InChIKey | WSUYFPNKFIUXDM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |