C13H27NO3S2 — CID 66375790
1-(3-ethylsulfonylthiomorpholin-4-yl)-4,4-dimethylpentan-3-ol (PubChem CID 66375790) has the molecular formula C13H27NO3S2 and a molecular weight of 309.50 g/mol. Its IUPAC name is 1-(3-ethylsulfonylthiomorpholin-4-yl)-4,4-dimethylpentan-3-ol.
| Compound Name | 1-(3-ethylsulfonylthiomorpholin-4-yl)-4,4-dimethylpentan-3-ol |
|---|---|
| PubChem CID | 66375790 |
| Molecular Formula | C13H27NO3S2 |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 1-(3-ethylsulfonylthiomorpholin-4-yl)-4,4-dimethylpentan-3-ol |
| SMILES | CCS(=O)(=O)C1CSCCN1CCC(O)C(C)(C)C |
| InChI | InChI=1S/C13H27NO3S2/c1-5-19(16,17)12-10-18-9-8-14(12)7-6-11(15)13(2,3)4/h11-12,15H,5-10H2,1-4H3 |
| InChIKey | MCPVLWFOGIJCIS-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |