C11H24N2O2S2 — CID 112736892
(2R)-1-(3-ethylsulfonylthiomorpholin-4-yl)-3-methylbutan-2-amine (PubChem CID 112736892) has the molecular formula C11H24N2O2S2 and a molecular weight of 280.46 g/mol. Its IUPAC name is (2R)-1-(3-ethylsulfonylthiomorpholin-4-yl)-3-methylbutan-2-amine.
| Compound Name | (2R)-1-(3-ethylsulfonylthiomorpholin-4-yl)-3-methylbutan-2-amine |
|---|---|
| PubChem CID | 112736892 |
| Molecular Formula | C11H24N2O2S2 |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | (2R)-1-(3-ethylsulfonylthiomorpholin-4-yl)-3-methylbutan-2-amine |
| SMILES | CCS(=O)(=O)C1CSCCN1C[C@H](N)C(C)C |
| InChI | InChI=1S/C11H24N2O2S2/c1-4-17(14,15)11-8-16-6-5-13(11)7-10(12)9(2)3/h9-11H,4-8,12H2,1-3H3/t10-,11?/m0/s1 |
| InChIKey | FJULYOIVLFABFU-VUWPPUDQSA-N |
| XLogP | 0.78 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |