C10H17F3N2O2S3 — CID 103368769
2-[(3-ethylsulfonylthiomorpholin-4-yl)methyl]-3,3,3-trifluoropropanethioamide (PubChem CID 103368769) has the molecular formula C10H17F3N2O2S3 and a molecular weight of 350.45 g/mol. Its IUPAC name is 2-[(3-ethylsulfonylthiomorpholin-4-yl)methyl]-3,3,3-trifluoropropanethioamide.
| Compound Name | 2-[(3-ethylsulfonylthiomorpholin-4-yl)methyl]-3,3,3-trifluoropropanethioamide |
|---|---|
| PubChem CID | 103368769 |
| Molecular Formula | C10H17F3N2O2S3 |
| Molecular Weight | 350.45 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | 2-[(3-ethylsulfonylthiomorpholin-4-yl)methyl]-3,3,3-trifluoropropanethioamide |
| SMILES | CCS(=O)(=O)C1CSCCN1CC(C(N)=S)C(F)(F)F |
| InChI | InChI=1S/C10H17F3N2O2S3/c1-2-20(16,17)8-6-19-4-3-15(8)5-7(9(14)18)10(11,12)13/h7-8H,2-6H2,1H3,(H2,14,18) |
| InChIKey | GULNWXRBMAMLIO-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.45 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|