C10H20N2O2S3 — CID 66384091
2-(3-ethylsulfonylthiomorpholin-4-yl)butanethioamide (PubChem CID 66384091) has the molecular formula C10H20N2O2S3 and a molecular weight of 296.48 g/mol. Its IUPAC name is 2-(3-ethylsulfonylthiomorpholin-4-yl)butanethioamide.
| Compound Name | 2-(3-ethylsulfonylthiomorpholin-4-yl)butanethioamide |
|---|---|
| PubChem CID | 66384091 |
| Molecular Formula | C10H20N2O2S3 |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 2-(3-ethylsulfonylthiomorpholin-4-yl)butanethioamide |
| SMILES | CCC(C(N)=S)N1CCSCC1S(=O)(=O)CC |
| InChI | InChI=1S/C10H20N2O2S3/c1-3-8(10(11)15)12-5-6-16-7-9(12)17(13,14)4-2/h8-9H,3-7H2,1-2H3,(H2,11,15) |
| InChIKey | UNHREJUQWPCUTO-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|