C9H18N2O3S2 — CID 66377719
3-(3-ethylsulfonylthiomorpholin-4-yl)propanamide (PubChem CID 66377719) has the molecular formula C9H18N2O3S2 and a molecular weight of 266.39 g/mol. Its IUPAC name is 3-(3-ethylsulfonylthiomorpholin-4-yl)propanamide.
| Compound Name | 3-(3-ethylsulfonylthiomorpholin-4-yl)propanamide |
|---|---|
| PubChem CID | 66377719 |
| Molecular Formula | C9H18N2O3S2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 3-(3-ethylsulfonylthiomorpholin-4-yl)propanamide |
| SMILES | CCS(=O)(=O)C1CSCCN1CCC(N)=O |
| InChI | InChI=1S/C9H18N2O3S2/c1-2-16(13,14)9-7-15-6-5-11(9)4-3-8(10)12/h9H,2-7H2,1H3,(H2,10,12) |
| InChIKey | LSALFUXEUPUTIL-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |