C12H25NO4S2 — CID 66376930
4-(2,2-diethoxyethyl)-3-ethylsulfonylthiomorpholine (PubChem CID 66376930) has the molecular formula C12H25NO4S2 and a molecular weight of 311.47 g/mol. Its IUPAC name is 4-(2,2-diethoxyethyl)-3-ethylsulfonylthiomorpholine.
| Compound Name | 4-(2,2-diethoxyethyl)-3-ethylsulfonylthiomorpholine |
|---|---|
| PubChem CID | 66376930 |
| Molecular Formula | C12H25NO4S2 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 4-(2,2-diethoxyethyl)-3-ethylsulfonylthiomorpholine |
| SMILES | CCOC(CN1CCSCC1S(=O)(=O)CC)OCC |
| InChI | InChI=1S/C12H25NO4S2/c1-4-16-12(17-5-2)9-13-7-8-18-10-11(13)19(14,15)6-3/h11-12H,4-10H2,1-3H3 |
| InChIKey | NMCRIQBCVXEVBD-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|