C14H22N2O2S2 — CID 66384766
3-methyl-N-[2-(3-methylsulfonylthiomorpholin-4-yl)ethyl]aniline (PubChem CID 66384766) has the molecular formula C14H22N2O2S2 and a molecular weight of 314.48 g/mol. Its IUPAC name is 3-methyl-N-[2-(3-methylsulfonylthiomorpholin-4-yl)ethyl]aniline.
| Compound Name | 3-methyl-N-[2-(3-methylsulfonylthiomorpholin-4-yl)ethyl]aniline |
|---|---|
| PubChem CID | 66384766 |
| Molecular Formula | C14H22N2O2S2 |
| Molecular Weight | 314.48 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 3-methyl-N-[2-(3-methylsulfonylthiomorpholin-4-yl)ethyl]aniline |
| SMILES | Cc1cccc(NCCN2CCSCC2S(C)(=O)=O)c1 |
| InChI | InChI=1S/C14H22N2O2S2/c1-12-4-3-5-13(10-12)15-6-7-16-8-9-19-11-14(16)20(2,17)18/h3-5,10,14-15H,6-9,11H2,1-2H3 |
| InChIKey | PBIGRCCDWCJNHG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.48 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |