C12H13BrClNO3S2 — CID 103765707
(2-bromo-4-chlorophenyl)-(3-methylsulfonylthiomorpholin-4-yl)methanone (PubChem CID 103765707) has the molecular formula C12H13BrClNO3S2 and a molecular weight of 398.73 g/mol. Its IUPAC name is (2-bromo-4-chlorophenyl)-(3-methylsulfonylthiomorpholin-4-yl)methanone.
| Compound Name | (2-bromo-4-chlorophenyl)-(3-methylsulfonylthiomorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 103765707 |
| Molecular Formula | C12H13BrClNO3S2 |
| Molecular Weight | 398.73 g/mol |
| Exact Mass | 396.92 |
| IUPAC Name | (2-bromo-4-chlorophenyl)-(3-methylsulfonylthiomorpholin-4-yl)methanone |
| SMILES | CS(=O)(=O)C1CSCCN1C(=O)c1ccc(Cl)cc1Br |
| InChI | InChI=1S/C12H13BrClNO3S2/c1-20(17,18)11-7-19-5-4-15(11)12(16)9-3-2-8(14)6-10(9)13/h2-3,6,11H,4-5,7H2,1H3 |
| InChIKey | WKFKYQWKTLFLGG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.73 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |