C11H13NO6S2 — CID 104607707
5-(3-methylsulfonylthiomorpholine-4-carbonyl)furan-3-carboxylic acid (PubChem CID 104607707) has the molecular formula C11H13NO6S2 and a molecular weight of 319.36 g/mol. Its IUPAC name is 5-(3-methylsulfonylthiomorpholine-4-carbonyl)furan-3-carboxylic acid.
| Compound Name | 5-(3-methylsulfonylthiomorpholine-4-carbonyl)furan-3-carboxylic acid |
|---|---|
| PubChem CID | 104607707 |
| Molecular Formula | C11H13NO6S2 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 5-(3-methylsulfonylthiomorpholine-4-carbonyl)furan-3-carboxylic acid |
| SMILES | CS(=O)(=O)C1CSCCN1C(=O)c1cc(C(=O)O)co1 |
| InChI | InChI=1S/C11H13NO6S2/c1-20(16,17)9-6-19-3-2-12(9)10(13)8-4-7(5-18-8)11(14)15/h4-5,9H,2-3,6H2,1H3,(H,14,15) |
| InChIKey | CBZKWRASHZYPCC-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |