C12H16ClN3O3S2 — CID 114923975
(2-amino-5-chloro-4-pyridinyl)-(3-ethylsulfonylthiomorpholin-4-yl)methanone (PubChem CID 114923975) has the molecular formula C12H16ClN3O3S2 and a molecular weight of 349.87 g/mol. Its IUPAC name is (2-amino-5-chloro-4-pyridinyl)-(3-ethylsulfonylthiomorpholin-4-yl)methanone.
| Compound Name | (2-amino-5-chloro-4-pyridinyl)-(3-ethylsulfonylthiomorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 114923975 |
| Molecular Formula | C12H16ClN3O3S2 |
| Molecular Weight | 349.87 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | (2-amino-5-chloro-4-pyridinyl)-(3-ethylsulfonylthiomorpholin-4-yl)methanone |
| SMILES | CCS(=O)(=O)C1CSCCN1C(=O)c1cc(N)ncc1Cl |
| InChI | InChI=1S/C12H16ClN3O3S2/c1-2-21(18,19)11-7-20-4-3-16(11)12(17)8-5-10(14)15-6-9(8)13/h5-6,11H,2-4,7H2,1H3,(H2,14,15) |
| InChIKey | MPZYLKFWRAWTQS-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.87 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |