C11H15NOS2 — CID 122140873
(2-propyl-1,3-thiazolidin-3-yl)-thiophen-2-ylmethanone (PubChem CID 122140873) has the molecular formula C11H15NOS2 and a molecular weight of 241.38 g/mol. Its IUPAC name is (2-propyl-1,3-thiazolidin-3-yl)-thiophen-2-ylmethanone.
| Compound Name | (2-propyl-1,3-thiazolidin-3-yl)-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 122140873 |
| Molecular Formula | C11H15NOS2 |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | (2-propyl-1,3-thiazolidin-3-yl)-thiophen-2-ylmethanone |
| SMILES | CCCC1SCCN1C(=O)c1cccs1 |
| InChI | InChI=1S/C11H15NOS2/c1-2-4-10-12(6-8-15-10)11(13)9-5-3-7-14-9/h3,5,7,10H,2,4,6,8H2,1H3 |
| InChIKey | YHHCHMMNVIQFSQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |