C11H11NO5S — CID 107721616
(4R)-3-(2,5-dihydroxybenzoyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 107721616) has the molecular formula C11H11NO5S and a molecular weight of 269.28 g/mol. Its IUPAC name is (4R)-3-(2,5-dihydroxybenzoyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (4R)-3-(2,5-dihydroxybenzoyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 107721616 |
| Molecular Formula | C11H11NO5S |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | (4R)-3-(2,5-dihydroxybenzoyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CSCN1C(=O)c1cc(O)ccc1O |
| InChI | InChI=1S/C11H11NO5S/c13-6-1-2-9(14)7(3-6)10(15)12-5-18-4-8(12)11(16)17/h1-3,8,13-14H,4-5H2,(H,16,17)/t8-/m0/s1 |
| InChIKey | HPHYFEBYFORBEO-QMMMGPOBSA-N |
| XLogP | 0.70 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|