C11H8F3NO3S — CID 79749977
(4R)-3-(2,3,4-trifluorobenzoyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 79749977) has the molecular formula C11H8F3NO3S and a molecular weight of 291.25 g/mol. Its IUPAC name is (4R)-3-(2,3,4-trifluorobenzoyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (4R)-3-(2,3,4-trifluorobenzoyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 79749977 |
| Molecular Formula | C11H8F3NO3S |
| Molecular Weight | 291.25 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | (4R)-3-(2,3,4-trifluorobenzoyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CSCN1C(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C11H8F3NO3S/c12-6-2-1-5(8(13)9(6)14)10(16)15-4-19-3-7(15)11(17)18/h1-2,7H,3-4H2,(H,17,18)/t7-/m0/s1 |
| InChIKey | NWVPRMKUZISTHB-ZETCQYMHSA-N |
| XLogP | 1.70 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.25 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|