C12H19N3O2S2 — CID 104535174
N-ethyl-5-(3-methylsulfonylthiomorpholin-4-yl)pyridin-3-amine (PubChem CID 104535174) has the molecular formula C12H19N3O2S2 and a molecular weight of 301.44 g/mol. Its IUPAC name is N-ethyl-5-(3-methylsulfonylthiomorpholin-4-yl)pyridin-3-amine.
| Compound Name | N-ethyl-5-(3-methylsulfonylthiomorpholin-4-yl)pyridin-3-amine |
|---|---|
| PubChem CID | 104535174 |
| Molecular Formula | C12H19N3O2S2 |
| Molecular Weight | 301.44 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | N-ethyl-5-(3-methylsulfonylthiomorpholin-4-yl)pyridin-3-amine |
| SMILES | CCNc1cncc(N2CCSCC2S(C)(=O)=O)c1 |
| InChI | InChI=1S/C12H19N3O2S2/c1-3-14-10-6-11(8-13-7-10)15-4-5-18-9-12(15)19(2,16)17/h6-8,12,14H,3-5,9H2,1-2H3 |
| InChIKey | WGDHWNWMCCJXSP-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.44 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |