C13H18F2N2O2S2 — CID 66383964
1-[3,5-difluoro-4-(3-methylsulfonylthiomorpholin-4-yl)phenyl]-N-methylmethanamine (PubChem CID 66383964) has the molecular formula C13H18F2N2O2S2 and a molecular weight of 336.43 g/mol. Its IUPAC name is 1-[3,5-difluoro-4-(3-methylsulfonylthiomorpholin-4-yl)phenyl]-N-methylmethanamine.
| Compound Name | 1-[3,5-difluoro-4-(3-methylsulfonylthiomorpholin-4-yl)phenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 66383964 |
| Molecular Formula | C13H18F2N2O2S2 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 1-[3,5-difluoro-4-(3-methylsulfonylthiomorpholin-4-yl)phenyl]-N-methylmethanamine |
| SMILES | CNCc1cc(F)c(N2CCSCC2S(C)(=O)=O)c(F)c1 |
| InChI | InChI=1S/C13H18F2N2O2S2/c1-16-7-9-5-10(14)13(11(15)6-9)17-3-4-20-8-12(17)21(2,18)19/h5-6,12,16H,3-4,7-8H2,1-2H3 |
| InChIKey | FARHGPVVIGDDQX-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|