C12H14FNO3S2 — CID 114067141
3-fluoro-2-(3-methylsulfonylthiomorpholin-4-yl)benzaldehyde (PubChem CID 114067141) has the molecular formula C12H14FNO3S2 and a molecular weight of 303.38 g/mol. Its IUPAC name is 3-fluoro-2-(3-methylsulfonylthiomorpholin-4-yl)benzaldehyde.
| Compound Name | 3-fluoro-2-(3-methylsulfonylthiomorpholin-4-yl)benzaldehyde |
|---|---|
| PubChem CID | 114067141 |
| Molecular Formula | C12H14FNO3S2 |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 3-fluoro-2-(3-methylsulfonylthiomorpholin-4-yl)benzaldehyde |
| SMILES | CS(=O)(=O)C1CSCCN1c1c(F)cccc1C=O |
| InChI | InChI=1S/C12H14FNO3S2/c1-19(16,17)11-8-18-6-5-14(11)12-9(7-15)3-2-4-10(12)13/h2-4,7,11H,5-6,8H2,1H3 |
| InChIKey | AYPJRIBYHQFQGX-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|