C11H18N2O4S4 — CID 66383875
N-methyl-1-[5-(3-methylsulfonylthiomorpholin-4-yl)sulfonylthiophen-3-yl]methanamine (PubChem CID 66383875) has the molecular formula C11H18N2O4S4 and a molecular weight of 370.54 g/mol. Its IUPAC name is N-methyl-1-[5-(3-methylsulfonylthiomorpholin-4-yl)sulfonylthiophen-3-yl]methanamine.
| Compound Name | N-methyl-1-[5-(3-methylsulfonylthiomorpholin-4-yl)sulfonylthiophen-3-yl]methanamine |
|---|---|
| PubChem CID | 66383875 |
| Molecular Formula | C11H18N2O4S4 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.01 |
| IUPAC Name | N-methyl-1-[5-(3-methylsulfonylthiomorpholin-4-yl)sulfonylthiophen-3-yl]methanamine |
| SMILES | CNCc1csc(S(=O)(=O)N2CCSCC2S(C)(=O)=O)c1 |
| InChI | InChI=1S/C11H18N2O4S4/c1-12-6-9-5-11(19-7-9)21(16,17)13-3-4-18-8-10(13)20(2,14)15/h5,7,10,12H,3-4,6,8H2,1-2H3 |
| InChIKey | VVENGMAQXHSZIS-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |