C10H13BrClNO4S4 — CID 66381886
4-[2-bromo-5-(chloromethyl)thiophen-3-yl]sulfonyl-3-methylsulfonylthiomorpholine (PubChem CID 66381886) has the molecular formula C10H13BrClNO4S4 and a molecular weight of 454.84 g/mol. Its IUPAC name is 4-[2-bromo-5-(chloromethyl)thiophen-3-yl]sulfonyl-3-methylsulfonylthiomorpholine.
| Compound Name | 4-[2-bromo-5-(chloromethyl)thiophen-3-yl]sulfonyl-3-methylsulfonylthiomorpholine |
|---|---|
| PubChem CID | 66381886 |
| Molecular Formula | C10H13BrClNO4S4 |
| Molecular Weight | 454.84 g/mol |
| Exact Mass | 452.86 |
| IUPAC Name | 4-[2-bromo-5-(chloromethyl)thiophen-3-yl]sulfonyl-3-methylsulfonylthiomorpholine |
| SMILES | CS(=O)(=O)C1CSCCN1S(=O)(=O)c1cc(CCl)sc1Br |
| InChI | InChI=1S/C10H13BrClNO4S4/c1-20(14,15)9-6-18-3-2-13(9)21(16,17)8-4-7(5-12)19-10(8)11/h4,9H,2-3,5-6H2,1H3 |
| InChIKey | ZCBPEAUULJUSCT-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.84 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|