C11H16N2O4S3 — CID 66383927
3-(3-methylsulfonylthiomorpholin-4-yl)sulfonylaniline (PubChem CID 66383927) has the molecular formula C11H16N2O4S3 and a molecular weight of 336.46 g/mol. Its IUPAC name is 3-(3-methylsulfonylthiomorpholin-4-yl)sulfonylaniline.
| Compound Name | 3-(3-methylsulfonylthiomorpholin-4-yl)sulfonylaniline |
|---|---|
| PubChem CID | 66383927 |
| Molecular Formula | C11H16N2O4S3 |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | 3-(3-methylsulfonylthiomorpholin-4-yl)sulfonylaniline |
| SMILES | CS(=O)(=O)C1CSCCN1S(=O)(=O)c1cccc(N)c1 |
| InChI | InChI=1S/C11H16N2O4S3/c1-19(14,15)11-8-18-6-5-13(11)20(16,17)10-4-2-3-9(12)7-10/h2-4,7,11H,5-6,8,12H2,1H3 |
| InChIKey | ONPPMTUBBBRWCL-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|