C11H14BrNO4S3 — CID 66384439
4-(2-bromophenyl)sulfonyl-3-methylsulfonylthiomorpholine (PubChem CID 66384439) has the molecular formula C11H14BrNO4S3 and a molecular weight of 400.34 g/mol. Its IUPAC name is 4-(2-bromophenyl)sulfonyl-3-methylsulfonylthiomorpholine.
| Compound Name | 4-(2-bromophenyl)sulfonyl-3-methylsulfonylthiomorpholine |
|---|---|
| PubChem CID | 66384439 |
| Molecular Formula | C11H14BrNO4S3 |
| Molecular Weight | 400.34 g/mol |
| Exact Mass | 398.93 |
| IUPAC Name | 4-(2-bromophenyl)sulfonyl-3-methylsulfonylthiomorpholine |
| SMILES | CS(=O)(=O)C1CSCCN1S(=O)(=O)c1ccccc1Br |
| InChI | InChI=1S/C11H14BrNO4S3/c1-19(14,15)11-8-18-7-6-13(11)20(16,17)10-5-3-2-4-9(10)12/h2-5,11H,6-8H2,1H3 |
| InChIKey | COBANZJWZKTRKD-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.34 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |