C12H16BrNO2S2 — CID 115634660
4-(2-bromophenyl)sulfonyl-2,3-dimethylthiomorpholine (PubChem CID 115634660) has the molecular formula C12H16BrNO2S2 and a molecular weight of 350.30 g/mol. Its IUPAC name is 4-(2-bromophenyl)sulfonyl-2,3-dimethylthiomorpholine.
| Compound Name | 4-(2-bromophenyl)sulfonyl-2,3-dimethylthiomorpholine |
|---|---|
| PubChem CID | 115634660 |
| Molecular Formula | C12H16BrNO2S2 |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 348.98 |
| IUPAC Name | 4-(2-bromophenyl)sulfonyl-2,3-dimethylthiomorpholine |
| SMILES | CC1SCCN(S(=O)(=O)c2ccccc2Br)C1C |
| InChI | InChI=1S/C12H16BrNO2S2/c1-9-10(2)17-8-7-14(9)18(15,16)12-6-4-3-5-11(12)13/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | PPNNCVXAOCTLHQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |