C13H19NO2S2 — CID 115671977
2,3-dimethyl-4-(2-methylphenyl)sulfonylthiomorpholine (PubChem CID 115671977) has the molecular formula C13H19NO2S2 and a molecular weight of 285.43 g/mol. Its IUPAC name is 2,3-dimethyl-4-(2-methylphenyl)sulfonylthiomorpholine.
| Compound Name | 2,3-dimethyl-4-(2-methylphenyl)sulfonylthiomorpholine |
|---|---|
| PubChem CID | 115671977 |
| Molecular Formula | C13H19NO2S2 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 2,3-dimethyl-4-(2-methylphenyl)sulfonylthiomorpholine |
| SMILES | Cc1ccccc1S(=O)(=O)N1CCSC(C)C1C |
| InChI | InChI=1S/C13H19NO2S2/c1-10-6-4-5-7-13(10)18(15,16)14-8-9-17-12(3)11(14)2/h4-7,11-12H,8-9H2,1-3H3 |
| InChIKey | LSOLFKQNNWSCDA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |