C13H17Cl2NO2S2 — CID 107091117
4-[3-chloro-4-(chloromethyl)phenyl]sulfonyl-2,3-dimethylthiomorpholine (PubChem CID 107091117) has the molecular formula C13H17Cl2NO2S2 and a molecular weight of 354.32 g/mol. Its IUPAC name is 4-[3-chloro-4-(chloromethyl)phenyl]sulfonyl-2,3-dimethylthiomorpholine.
| Compound Name | 4-[3-chloro-4-(chloromethyl)phenyl]sulfonyl-2,3-dimethylthiomorpholine |
|---|---|
| PubChem CID | 107091117 |
| Molecular Formula | C13H17Cl2NO2S2 |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | 4-[3-chloro-4-(chloromethyl)phenyl]sulfonyl-2,3-dimethylthiomorpholine |
| SMILES | CC1SCCN(S(=O)(=O)c2ccc(CCl)c(Cl)c2)C1C |
| InChI | InChI=1S/C13H17Cl2NO2S2/c1-9-10(2)19-6-5-16(9)20(17,18)12-4-3-11(8-14)13(15)7-12/h3-4,7,9-10H,5-6,8H2,1-2H3 |
| InChIKey | BIRPCGZCCYTMLM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|