C14H19Cl2NO2S — CID 107091042
1-[3-chloro-4-(chloromethyl)phenyl]sulfonyl-4-ethylpiperidine (PubChem CID 107091042) has the molecular formula C14H19Cl2NO2S and a molecular weight of 336.28 g/mol. Its IUPAC name is 1-[3-chloro-4-(chloromethyl)phenyl]sulfonyl-4-ethylpiperidine.
| Compound Name | 1-[3-chloro-4-(chloromethyl)phenyl]sulfonyl-4-ethylpiperidine |
|---|---|
| PubChem CID | 107091042 |
| Molecular Formula | C14H19Cl2NO2S |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 1-[3-chloro-4-(chloromethyl)phenyl]sulfonyl-4-ethylpiperidine |
| SMILES | CCC1CCN(S(=O)(=O)c2ccc(CCl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C14H19Cl2NO2S/c1-2-11-5-7-17(8-6-11)20(18,19)13-4-3-12(10-15)14(16)9-13/h3-4,9,11H,2,5-8,10H2,1H3 |
| InChIKey | XNNLBCSXEZWGBO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|