C14H13Cl2NO2S2 — CID 107090927
5-[3-chloro-4-(chloromethyl)phenyl]sulfonyl-6,7-dihydro-4H-thieno[3,2-c]pyridine (PubChem CID 107090927) has the molecular formula C14H13Cl2NO2S2 and a molecular weight of 362.30 g/mol. Its IUPAC name is 5-[3-chloro-4-(chloromethyl)phenyl]sulfonyl-6,7-dihydro-4H-thieno[3,2-c]pyridine.
| Compound Name | 5-[3-chloro-4-(chloromethyl)phenyl]sulfonyl-6,7-dihydro-4H-thieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 107090927 |
| Molecular Formula | C14H13Cl2NO2S2 |
| Molecular Weight | 362.30 g/mol |
| Exact Mass | 360.98 |
| IUPAC Name | 5-[3-chloro-4-(chloromethyl)phenyl]sulfonyl-6,7-dihydro-4H-thieno[3,2-c]pyridine |
| SMILES | O=S(=O)(c1ccc(CCl)c(Cl)c1)N1CCc2sccc2C1 |
| InChI | InChI=1S/C14H13Cl2NO2S2/c15-8-10-1-2-12(7-13(10)16)21(18,19)17-5-3-14-11(9-17)4-6-20-14/h1-2,4,6-7H,3,5,8-9H2 |
| InChIKey | DUZFTPSSQZVHCI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.30 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|