C8H10ClNO2S2 — CID 63666976
5-(chloromethylsulfonyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine (PubChem CID 63666976) has the molecular formula C8H10ClNO2S2 and a molecular weight of 251.76 g/mol. Its IUPAC name is 5-(chloromethylsulfonyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine.
| Compound Name | 5-(chloromethylsulfonyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 63666976 |
| Molecular Formula | C8H10ClNO2S2 |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 250.98 |
| IUPAC Name | 5-(chloromethylsulfonyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine |
| SMILES | O=S(=O)(CCl)N1CCc2sccc2C1 |
| InChI | InChI=1S/C8H10ClNO2S2/c9-6-14(11,12)10-3-1-8-7(5-10)2-4-13-8/h2,4H,1,3,5-6H2 |
| InChIKey | XUWRHQISBHWWKQ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|