C13H20N2O2S2 — CID 30289320
5-(azepan-1-ylsulfonyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine (PubChem CID 30289320) has the molecular formula C13H20N2O2S2 and a molecular weight of 300.45 g/mol. Its IUPAC name is 5-(azepan-1-ylsulfonyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine.
| Compound Name | 5-(azepan-1-ylsulfonyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 30289320 |
| Molecular Formula | C13H20N2O2S2 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 5-(azepan-1-ylsulfonyl)-6,7-dihydro-4H-thieno[3,2-c]pyridine |
| SMILES | O=S(=O)(N1CCCCCC1)N1CCc2sccc2C1 |
| InChI | InChI=1S/C13H20N2O2S2/c16-19(17,14-7-3-1-2-4-8-14)15-9-5-13-12(11-15)6-10-18-13/h6,10H,1-5,7-9,11H2 |
| InChIKey | HROVVCSHDUZPQV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |