C13H13BrN2O2S2 — CID 43255751
3-bromo-4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylsulfonyl)aniline (PubChem CID 43255751) has the molecular formula C13H13BrN2O2S2 and a molecular weight of 373.30 g/mol. Its IUPAC name is 3-bromo-4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylsulfonyl)aniline.
| Compound Name | 3-bromo-4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylsulfonyl)aniline |
|---|---|
| PubChem CID | 43255751 |
| Molecular Formula | C13H13BrN2O2S2 |
| Molecular Weight | 373.30 g/mol |
| Exact Mass | 371.96 |
| IUPAC Name | 3-bromo-4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylsulfonyl)aniline |
| SMILES | Nc1ccc(S(=O)(=O)N2CCc3sccc3C2)c(Br)c1 |
| InChI | InChI=1S/C13H13BrN2O2S2/c14-11-7-10(15)1-2-13(11)20(17,18)16-5-3-12-9(8-16)4-6-19-12/h1-2,4,6-7H,3,5,8,15H2 |
| InChIKey | QQZOPYQPMTWIDM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.30 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|