C15H16BrN3OS — CID 43375514
N-(4-amino-2-bromophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetamide (PubChem CID 43375514) has the molecular formula C15H16BrN3OS and a molecular weight of 366.28 g/mol. Its IUPAC name is N-(4-amino-2-bromophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetamide.
| Compound Name | N-(4-amino-2-bromophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetamide |
|---|---|
| PubChem CID | 43375514 |
| Molecular Formula | C15H16BrN3OS |
| Molecular Weight | 366.28 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | N-(4-amino-2-bromophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetamide |
| SMILES | Nc1ccc(NC(=O)CN2CCc3sccc3C2)c(Br)c1 |
| InChI | InChI=1S/C15H16BrN3OS/c16-12-7-11(17)1-2-13(12)18-15(20)9-19-5-3-14-10(8-19)4-6-21-14/h1-2,4,6-7H,3,5,8-9,17H2,(H,18,20) |
| InChIKey | JAIGXNOAYKUWJE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.28 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|