C12H16BrN3O3S — CID 43581094
N-(4-amino-2-bromophenyl)-2-(1,1-dioxo-1,4-thiazinan-4-yl)acetamide (PubChem CID 43581094) has the molecular formula C12H16BrN3O3S and a molecular weight of 362.25 g/mol. Its IUPAC name is N-(4-amino-2-bromophenyl)-2-(1,1-dioxo-1,4-thiazinan-4-yl)acetamide.
| Compound Name | N-(4-amino-2-bromophenyl)-2-(1,1-dioxo-1,4-thiazinan-4-yl)acetamide |
|---|---|
| PubChem CID | 43581094 |
| Molecular Formula | C12H16BrN3O3S |
| Molecular Weight | 362.25 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | N-(4-amino-2-bromophenyl)-2-(1,1-dioxo-1,4-thiazinan-4-yl)acetamide |
| SMILES | Nc1ccc(NC(=O)CN2CCS(=O)(=O)CC2)c(Br)c1 |
| InChI | InChI=1S/C12H16BrN3O3S/c13-10-7-9(14)1-2-11(10)15-12(17)8-16-3-5-20(18,19)6-4-16/h1-2,7H,3-6,8,14H2,(H,15,17) |
| InChIKey | TZEQJTDRJBFCDI-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.25 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|