C13H12ClFN2O2S2 — CID 61112259
4-chloro-5-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylsulfonyl)-2-fluoroaniline (PubChem CID 61112259) has the molecular formula C13H12ClFN2O2S2 and a molecular weight of 346.84 g/mol. Its IUPAC name is 4-chloro-5-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylsulfonyl)-2-fluoroaniline.
| Compound Name | 4-chloro-5-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylsulfonyl)-2-fluoroaniline |
|---|---|
| PubChem CID | 61112259 |
| Molecular Formula | C13H12ClFN2O2S2 |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.00 |
| IUPAC Name | 4-chloro-5-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylsulfonyl)-2-fluoroaniline |
| SMILES | Nc1cc(S(=O)(=O)N2CCc3sccc3C2)c(Cl)cc1F |
| InChI | InChI=1S/C13H12ClFN2O2S2/c14-9-5-10(15)11(16)6-13(9)21(18,19)17-3-1-12-8(7-17)2-4-20-12/h2,4-6H,1,3,7,16H2 |
| InChIKey | SVQGMCFBMJAGOD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|