C11H14ClFN2O2S2 — CID 61419326
4-chloro-2-fluoro-5-(1,4-thiazepan-4-ylsulfonyl)aniline (PubChem CID 61419326) has the molecular formula C11H14ClFN2O2S2 and a molecular weight of 324.83 g/mol. Its IUPAC name is 4-chloro-2-fluoro-5-(1,4-thiazepan-4-ylsulfonyl)aniline.
| Compound Name | 4-chloro-2-fluoro-5-(1,4-thiazepan-4-ylsulfonyl)aniline |
|---|---|
| PubChem CID | 61419326 |
| Molecular Formula | C11H14ClFN2O2S2 |
| Molecular Weight | 324.83 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | 4-chloro-2-fluoro-5-(1,4-thiazepan-4-ylsulfonyl)aniline |
| SMILES | Nc1cc(S(=O)(=O)N2CCCSCC2)c(Cl)cc1F |
| InChI | InChI=1S/C11H14ClFN2O2S2/c12-8-6-9(13)10(14)7-11(8)19(16,17)15-2-1-4-18-5-3-15/h6-7H,1-5,14H2 |
| InChIKey | LLZZMDLNVSOTES-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.83 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|