C12H13F2NO4S2 — CID 104654542
3,4-difluoro-5-(1,4-thiazepan-4-ylsulfonyl)benzoic acid (PubChem CID 104654542) has the molecular formula C12H13F2NO4S2 and a molecular weight of 337.37 g/mol. Its IUPAC name is 3,4-difluoro-5-(1,4-thiazepan-4-ylsulfonyl)benzoic acid.
| Compound Name | 3,4-difluoro-5-(1,4-thiazepan-4-ylsulfonyl)benzoic acid |
|---|---|
| PubChem CID | 104654542 |
| Molecular Formula | C12H13F2NO4S2 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | 3,4-difluoro-5-(1,4-thiazepan-4-ylsulfonyl)benzoic acid |
| SMILES | O=C(O)c1cc(F)c(F)c(S(=O)(=O)N2CCCSCC2)c1 |
| InChI | InChI=1S/C12H13F2NO4S2/c13-9-6-8(12(16)17)7-10(11(9)14)21(18,19)15-2-1-4-20-5-3-15/h6-7H,1-5H2,(H,16,17) |
| InChIKey | UZLQXVWXPOYYRN-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |