C17H19NO2S2 — CID 51116230
4-(2-phenylphenyl)sulfonyl-1,4-thiazepane (PubChem CID 51116230) has the molecular formula C17H19NO2S2 and a molecular weight of 333.48 g/mol. Its IUPAC name is 4-(2-phenylphenyl)sulfonyl-1,4-thiazepane.
| Compound Name | 4-(2-phenylphenyl)sulfonyl-1,4-thiazepane |
|---|---|
| PubChem CID | 51116230 |
| Molecular Formula | C17H19NO2S2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 4-(2-phenylphenyl)sulfonyl-1,4-thiazepane |
| SMILES | O=S(=O)(c1ccccc1-c1ccccc1)N1CCCSCC1 |
| InChI | InChI=1S/C17H19NO2S2/c19-22(20,18-11-6-13-21-14-12-18)17-10-5-4-9-16(17)15-7-2-1-3-8-15/h1-5,7-10H,6,11-14H2 |
| InChIKey | LUIVEODOASQLKS-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |