C23H24N2O4S2 — CID 166194214
1-(benzenesulfonyl)-4-(2-phenylphenyl)sulfonyl-1,4-diazepane (PubChem CID 166194214) has the molecular formula C23H24N2O4S2 and a molecular weight of 456.59 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-4-(2-phenylphenyl)sulfonyl-1,4-diazepane.
| Compound Name | 1-(benzenesulfonyl)-4-(2-phenylphenyl)sulfonyl-1,4-diazepane |
|---|---|
| PubChem CID | 166194214 |
| Molecular Formula | C23H24N2O4S2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 1-(benzenesulfonyl)-4-(2-phenylphenyl)sulfonyl-1,4-diazepane |
| SMILES | O=S(=O)(c1ccccc1)N1CCCN(S(=O)(=O)c2ccccc2-c2ccccc2)CC1 |
| InChI | InChI=1S/C23H24N2O4S2/c26-30(27,21-12-5-2-6-13-21)24-16-9-17-25(19-18-24)31(28,29)23-15-8-7-14-22(23)20-10-3-1-4-11-20/h1-8,10-15H,9,16-19H2 |
| InChIKey | MRDYZUQWUPYMLC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |