About 7-(2-phenylphenyl)sulfonyl-3λ6-thia-7-azabicyclo[3.3.1]nonane 3,3-dioxide
7-(2-phenylphenyl)sulfonyl-3λ6-thia-7-azabicyclo[3.3.1]nonane 3,3-dioxide (PubChem CID 167886953) has the molecular formula C19H21NO4S2
and a molecular weight of 391.51 g/mol. Its IUPAC name is 7-(2-phenylphenyl)sulfonyl-3λ6-thia-7-azabicyclo[3.3.1]nonane 3,3-dioxide.
Molecular Properties
| Compound Name | 7-(2-phenylphenyl)sulfonyl-3λ6-thia-7-azabicyclo[3.3.1]nonane 3,3-dioxide |
| PubChem CID | 167886953 |
| Molecular Formula | C19H21NO4S2 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 7-(2-phenylphenyl)sulfonyl-3λ6-thia-7-azabicyclo[3.3.1]nonane 3,3-dioxide |
| SMILES | O=S1(=O)CC2CC(CN(S(=O)(=O)c3ccccc3-c3ccccc3)C2)C1 |
| InChI | InChI=1S/C19H21NO4S2/c21-25(22)13-15-10-16(14-25)12-20(11-15)26(23,24)19-9-5-4-8-18(19)17-6-2-1-3-7-17/h1-9,15-16H,10-14H2 |
| InChIKey | AAMGSSCSVWYSMK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-(2-phenylphenyl)sulfonyl-3λ6-thia-7-azabicyclo[3.3.1]nonane 3,3-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2-phenylphenyl)sulfonyl-3λ6-thia-7-azabicyclo[3.3.1]nonane 3,3-dioxide?
The IUPAC name of 7-(2-phenylphenyl)sulfonyl-3λ6-thia-7-azabicyclo[3.3.1]nonane 3,3-dioxide (CID 167886953) is 7-(2-phenylphenyl)sulfonyl-3λ6-thia-7-azabicyclo[3.3.1]nonane 3,3-dioxide.
What is the SMILES notation for 7-(2-phenylphenyl)sulfonyl-3λ6-thia-7-azabicyclo[3.3.1]nonane 3,3-dioxide?
The canonical SMILES for 7-(2-phenylphenyl)sulfonyl-3λ6-thia-7-azabicyclo[3.3.1]nonane 3,3-dioxide is O=S1(=O)CC2CC(CN(S(=O)(=O)c3ccccc3-c3ccccc3)C2)C1.
What is the InChIKey of 7-(2-phenylphenyl)sulfonyl-3λ6-thia-7-azabicyclo[3.3.1]nonane 3,3-dioxide?
The InChIKey is AAMGSSCSVWYSMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21NO4S2/c21-25(22)13-15-10-16(14-25)12-20(11-15)26(23,24)19-9-5-4-8-18(19)17-6-2-1-3-7-17/h1-9,15-16H,10-14H2.
What are the key properties of 7-(2-phenylphenyl)sulfonyl-3λ6-thia-7-azabicyclo[3.3.1]nonane 3,3-dioxide?
7-(2-phenylphenyl)sulfonyl-3λ6-thia-7-azabicyclo[3.3.1]nonane 3,3-dioxide has a molecular weight of 391.51 g/mol, XLogP of 2.41, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2-phenylphenyl)sulfonyl-3λ6-thia-7-azabicyclo[3.3.1]nonane 3,3-dioxide is sourced from PubChem (CID 167886953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).