C13H21N3O4S2 — CID 110799693
4-(benzenesulfonyl)-N,N-dimethyl-1,4-diazepane-1-sulfonamide (PubChem CID 110799693) has the molecular formula C13H21N3O4S2 and a molecular weight of 347.46 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-N,N-dimethyl-1,4-diazepane-1-sulfonamide.
| Compound Name | 4-(benzenesulfonyl)-N,N-dimethyl-1,4-diazepane-1-sulfonamide |
|---|---|
| PubChem CID | 110799693 |
| Molecular Formula | C13H21N3O4S2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 4-(benzenesulfonyl)-N,N-dimethyl-1,4-diazepane-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C13H21N3O4S2/c1-14(2)22(19,20)16-10-6-9-15(11-12-16)21(17,18)13-7-4-3-5-8-13/h3-5,7-8H,6,9-12H2,1-2H3 |
| InChIKey | DDGWKMDBUIYFSV-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |