C10H16N2O2S3 — CID 61423571
[5-(1,4-thiazepan-4-ylsulfonyl)thiophen-2-yl]methanamine (PubChem CID 61423571) has the molecular formula C10H16N2O2S3 and a molecular weight of 292.45 g/mol. Its IUPAC name is [5-(1,4-thiazepan-4-ylsulfonyl)thiophen-2-yl]methanamine.
| Compound Name | [5-(1,4-thiazepan-4-ylsulfonyl)thiophen-2-yl]methanamine |
|---|---|
| PubChem CID | 61423571 |
| Molecular Formula | C10H16N2O2S3 |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | [5-(1,4-thiazepan-4-ylsulfonyl)thiophen-2-yl]methanamine |
| SMILES | NCc1ccc(S(=O)(=O)N2CCCSCC2)s1 |
| InChI | InChI=1S/C10H16N2O2S3/c11-8-9-2-3-10(16-9)17(13,14)12-4-1-6-15-7-5-12/h2-3H,1,4-8,11H2 |
| InChIKey | XJKSHMMKEAIYLS-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |